C30H55N3O10 — CID 90251286
(2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2R,3R,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol (PubChem CID 90251286) has the molecular formula C30H55N3O10 and a molecular weight of 617.78 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2R,3R,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2R,3R,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90251286 |
| Molecular Formula | C30H55N3O10 |
| Molecular Weight | 617.78 g/mol |
| Exact Mass | 617.39 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-[4-[(2R,3R,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]triazol-1-yl]oxane-3,4,5-triol |
| SMILES | CCCCOC[C@H]1O[C@H](c2cn([C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)nn2)C(OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C30H55N3O10/c1-5-9-13-38-19-22-27(39-14-10-6-2)29(41-16-12-8-4)28(40-15-11-7-3)26(42-22)20-17-33(32-31-20)30-25(37)24(36)23(35)21(18-34)43-30/h17,21-30,34-37H,5-16,18-19H2,1-4H3/t21-,22-,23-,24+,25+,26-,27-,28?,29+,30+/m1/s1 |
| InChIKey | KMCBWRQVBHVPBY-LFOGHEFUSA-N |
| XLogP | 2.06 |
| TPSA | 167.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.78 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|