C36H42BrN3O2Si — CID 90251328
(6aR,9R)-5-bromo-N-[(3S)-6-[hydroxy(diphenyl)silyl]-6-methylheptan-3-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 90251328) has the molecular formula C36H42BrN3O2Si and a molecular weight of 656.74 g/mol. Its IUPAC name is (6aR,9R)-5-bromo-N-[(3S)-6-[hydroxy(diphenyl)silyl]-6-methylheptan-3-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-5-bromo-N-[(3S)-6-[hydroxy(diphenyl)silyl]-6-methylheptan-3-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 90251328 |
| Molecular Formula | C36H42BrN3O2Si |
| Molecular Weight | 656.74 g/mol |
| Exact Mass | 655.22 |
| IUPAC Name | (6aR,9R)-5-bromo-N-[(3S)-6-[hydroxy(diphenyl)silyl]-6-methylheptan-3-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CC[C@@H](CCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1)NC(=O)[C@@H]1C=C2c3cccc4[nH]c(Br)c(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C36H42BrN3O2Si/c1-5-25(19-20-36(2,3)43(42,26-13-8-6-9-14-26)27-15-10-7-11-16-27)38-35(41)24-21-29-28-17-12-18-31-33(28)30(34(37)39-31)22-32(29)40(4)23-24/h6-18,21,24-25,32,39,42H,5,19-20,22-23H2,1-4H3,(H,38,41)/t24-,25+,32-/m1/s1 |
| InChIKey | BGJVNQYOVXCYSR-OVWOLCBMSA-N |
| XLogP | 6.01 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|