C42H37FIN5O5 — CID 90251473
[(2R,3S,4S,5R)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-ethynyl-5-fluoro-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate (PubChem CID 90251473) has the molecular formula C42H37FIN5O5 and a molecular weight of 837.69 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-ethynyl-5-fluoro-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4S,5R)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-ethynyl-5-fluoro-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 90251473 |
| Molecular Formula | C42H37FIN5O5 |
| Molecular Weight | 837.69 g/mol |
| Exact Mass | 837.18 |
| IUPAC Name | [(2R,3S,4S,5R)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-3-ethynyl-5-fluoro-5-(iodomethyl)-4-methyloxolan-3-yl] benzoate |
| SMILES | C#C[C@]1(OC(=O)c2ccccc2)[C@H](n2cnc3c(OCC)nc(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)nc32)O[C@](F)(CI)[C@H]1C |
| InChI | InChI=1S/C42H37FIN5O5/c1-5-40(53-37(50)29-16-10-7-11-17-29)28(3)41(43,26-44)54-38(40)49-27-45-34-35(49)46-39(47-36(34)52-6-2)48-42(30-18-12-8-13-19-30,31-20-14-9-15-21-31)32-22-24-33(51-4)25-23-32/h1,7-25,27-28,38H,6,26H2,2-4H3,(H,46,47,48)/t28-,38+,40+,41+/m0/s1 |
| InChIKey | DKYIUUNPFQETTE-UUWXULBBSA-N |
| XLogP | 8.13 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.69 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|