C12H17F2N3O2 — CID 90251491
4-amino-1-[(2R,3R,4S,5S)-5-ethyl-3,5-difluoro-3,4-dimethyloxolan-2-yl]pyrimidin-2-one (PubChem CID 90251491) has the molecular formula C12H17F2N3O2 and a molecular weight of 273.28 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5S)-5-ethyl-3,5-difluoro-3,4-dimethyloxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4S,5S)-5-ethyl-3,5-difluoro-3,4-dimethyloxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 90251491 |
| Molecular Formula | C12H17F2N3O2 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5S)-5-ethyl-3,5-difluoro-3,4-dimethyloxolan-2-yl]pyrimidin-2-one |
| SMILES | CC[C@@]1(F)O[C@@H](n2ccc(N)nc2=O)[C@](C)(F)[C@@H]1C |
| InChI | InChI=1S/C12H17F2N3O2/c1-4-12(14)7(2)11(3,13)9(19-12)17-6-5-8(15)16-10(17)18/h5-7,9H,4H2,1-3H3,(H2,15,16,18)/t7-,9+,11+,12+/m0/s1 |
| InChIKey | SUXXHIFSHOJDRH-ZPKWADRFSA-N |
| XLogP | 1.79 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |