C42H42FN5O5 — CID 90251516
[(2R,3R,4S,5S)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-5-ethyl-5-fluoro-3,4-dimethyloxolan-3-yl] benzoate (PubChem CID 90251516) has the molecular formula C42H42FN5O5 and a molecular weight of 715.83 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-5-ethyl-5-fluoro-3,4-dimethyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-5-ethyl-5-fluoro-3,4-dimethyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 90251516 |
| Molecular Formula | C42H42FN5O5 |
| Molecular Weight | 715.83 g/mol |
| Exact Mass | 715.32 |
| IUPAC Name | [(2R,3R,4S,5S)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-5-ethyl-5-fluoro-3,4-dimethyloxolan-3-yl] benzoate |
| SMILES | CCOc1nc(NC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)nc2c1ncn2[C@@H]1O[C@](F)(CC)[C@@H](C)[C@@]1(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C42H42FN5O5/c1-6-41(43)28(3)40(4,52-37(49)29-17-11-8-12-18-29)38(53-41)48-27-44-34-35(48)45-39(46-36(34)51-7-2)47-42(30-19-13-9-14-20-30,31-21-15-10-16-22-31)32-23-25-33(50-5)26-24-32/h8-28,38H,6-7H2,1-5H3,(H,45,46,47)/t28-,38+,40+,41+/m0/s1 |
| InChIKey | SRXMMRBOKSXCHD-UUWXULBBSA-N |
| XLogP | 8.49 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.83 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|