C28H38FN6O9P — CID 90251549
cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90251549) has the molecular formula C28H38FN6O9P and a molecular weight of 652.62 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90251549 |
| Molecular Formula | C28H38FN6O9P |
| Molecular Weight | 652.62 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@](F)(COP(=O)(N[C@@H](C)C(=O)OC2CCCCC2)Oc2ccccc2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C28H38FN6O9P/c1-4-40-22-20-21(32-26(30)33-22)35(16-31-20)25-27(3,38)24(37)28(29,43-25)15-41-45(39,44-19-13-9-6-10-14-19)34-17(2)23(36)42-18-11-7-5-8-12-18/h6,9-10,13-14,16-18,24-25,37-38H,4-5,7-8,11-12,15H2,1-3H3,(H,34,39)(H2,30,32,33)/t17-,24-,25+,27+,28+,45?/m0/s1 |
| InChIKey | BGNGOARIYWCZSI-WWOJCHJISA-N |
| XLogP | 3.17 |
| TPSA | 202.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|