C27H37F2N6O8P — CID 90251592
pentan-3-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90251592) has the molecular formula C27H37F2N6O8P and a molecular weight of 642.60 g/mol. Its IUPAC name is pentan-3-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | pentan-3-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90251592 |
| Molecular Formula | C27H37F2N6O8P |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | pentan-3-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@](F)(COP(=O)(N[C@@H](C)C(=O)OC(CC)CC)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C27H37F2N6O8P/c1-6-17(7-2)41-22(36)16(4)34-44(38,43-18-12-10-9-11-13-18)40-14-27(29)23(37)26(5,28)24(42-27)35-15-31-19-20(35)32-25(30)33-21(19)39-8-3/h9-13,15-17,23-24,37H,6-8,14H2,1-5H3,(H,34,38)(H2,30,32,33)/t16-,23-,24+,26+,27+,44?/m0/s1 |
| InChIKey | GNFIUVVPDRSYBT-DGTPREIISA-N |
| XLogP | 4.00 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|