C27H35F2N6O8P — CID 90251600
cyclopentyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90251600) has the molecular formula C27H35F2N6O8P and a molecular weight of 640.58 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclopentyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90251600 |
| Molecular Formula | C27H35F2N6O8P |
| Molecular Weight | 640.58 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | cyclopentyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@](F)(COP(=O)(N[C@@H](C)C(=O)OC2CCCC2)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C27H35F2N6O8P/c1-4-39-21-19-20(32-25(30)33-21)35(15-31-19)24-26(3,28)23(37)27(29,42-24)14-40-44(38,43-18-12-6-5-7-13-18)34-16(2)22(36)41-17-10-8-9-11-17/h5-7,12-13,15-17,23-24,37H,4,8-11,14H2,1-3H3,(H,34,38)(H2,30,32,33)/t16-,23-,24+,26+,27+,44?/m0/s1 |
| InChIKey | RCQMSRGEYMQKAO-DGTPREIISA-N |
| XLogP | 3.76 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|