C29H33F2N7O3 — CID 90252125
methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(methoxymethyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylcarbamate (PubChem CID 90252125) has the molecular formula C29H33F2N7O3 and a molecular weight of 565.63 g/mol. Its IUPAC name is methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(methoxymethyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylcarbamate.
| Compound Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(methoxymethyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 90252125 |
| Molecular Formula | C29H33F2N7O3 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(methoxymethyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylcarbamate |
| SMILES | COCc1cc(F)c(-c2ccc3cnc(Nc4cnccc4[C@H]4C[C@@H](N)[C@@H](N(C)C(=O)OC)[C@@H](C)C4)n3n2)c(F)c1 |
| InChI | InChI=1S/C29H33F2N7O3/c1-16-9-18(12-23(32)27(16)37(2)29(39)41-4)20-7-8-33-14-25(20)35-28-34-13-19-5-6-24(36-38(19)28)26-21(30)10-17(15-40-3)11-22(26)31/h5-8,10-11,13-14,16,18,23,27H,9,12,15,32H2,1-4H3,(H,34,35)/t16-,18+,23+,27-/m0/s1 |
| InChIKey | WNDMQMGZCPUQHR-HHTOWWSXSA-N |
| XLogP | 4.87 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |