C29H31F3N6O2 — CID 90252302
(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexan-1-ol (PubChem CID 90252302) has the molecular formula C29H31F3N6O2 and a molecular weight of 552.60 g/mol. Its IUPAC name is (1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexan-1-ol.
| Compound Name | (1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 90252302 |
| Molecular Formula | C29H31F3N6O2 |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | (1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexan-1-ol |
| SMILES | C[C@H]1C[C@@H](c2ccncc2Nc2ncc3ccc(-c4c(F)cc(C5(F)CCOCC5)cc4F)nn23)C[C@@H](N)[C@H]1O |
| InChI | InChI=1S/C29H31F3N6O2/c1-16-10-17(11-23(33)27(16)39)20-4-7-34-15-25(20)36-28-35-14-19-2-3-24(37-38(19)28)26-21(30)12-18(13-22(26)31)29(32)5-8-40-9-6-29/h2-4,7,12-17,23,27,39H,5-6,8-11,33H2,1H3,(H,35,36)/t16-,17+,23+,27-/m0/s1 |
| InChIKey | ONPQRFUFHGJISG-SQMLSJJLSA-N |
| XLogP | 4.99 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |