C29H32F2N6O2 — CID 90252352
(1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexan-1-ol (PubChem CID 90252352) has the molecular formula C29H32F2N6O2 and a molecular weight of 534.61 g/mol. Its IUPAC name is (1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexan-1-ol.
| Compound Name | (1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 90252352 |
| Molecular Formula | C29H32F2N6O2 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | (1R,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(oxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexan-1-ol |
| SMILES | C[C@H]1C[C@@H](c2ccncc2Nc2ncc3ccc(-c4c(F)cc(C5CCOCC5)cc4F)nn23)C[C@@H](N)[C@@H]1O |
| InChI | InChI=1S/C29H32F2N6O2/c1-16-10-19(13-24(32)28(16)38)21-4-7-33-15-26(21)35-29-34-14-20-2-3-25(36-37(20)29)27-22(30)11-18(12-23(27)31)17-5-8-39-9-6-17/h2-4,7,11-12,14-17,19,24,28,38H,5-6,8-10,13,32H2,1H3,(H,34,35)/t16-,19+,24+,28+/m0/s1 |
| InChIKey | ADNWXABRDCCTFP-MKUKGVIFSA-N |
| XLogP | 4.91 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |