C30H35F2N7O2 — CID 90252613
N-[(1S,2R,6S)-2-amino-4-[3-[[2-[4-(ethoxymethyl)-2,6-difluorophenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylacetamide (PubChem CID 90252613) has the molecular formula C30H35F2N7O2 and a molecular weight of 563.65 g/mol. Its IUPAC name is N-[(1S,2R,6S)-2-amino-4-[3-[[2-[4-(ethoxymethyl)-2,6-difluorophenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylacetamide.
| Compound Name | N-[(1S,2R,6S)-2-amino-4-[3-[[2-[4-(ethoxymethyl)-2,6-difluorophenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylacetamide |
|---|---|
| PubChem CID | 90252613 |
| Molecular Formula | C30H35F2N7O2 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | N-[(1S,2R,6S)-2-amino-4-[3-[[2-[4-(ethoxymethyl)-2,6-difluorophenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylacetamide |
| SMILES | CCOCc1cc(F)c(-c2ccc3cnc(Nc4cnccc4C4C[C@@H](N)[C@@H](N(C)C(C)=O)[C@@H](C)C4)n3n2)c(F)c1 |
| InChI | InChI=1S/C30H35F2N7O2/c1-5-41-16-19-11-23(31)28(24(32)12-19)26-7-6-21-14-35-30(39(21)37-26)36-27-15-34-9-8-22(27)20-10-17(2)29(25(33)13-20)38(4)18(3)40/h6-9,11-12,14-15,17,20,25,29H,5,10,13,16,33H2,1-4H3,(H,35,36)/t17-,20?,25+,29-/m0/s1 |
| InChIKey | HKZQIGIMRMPYGU-NRKFZGSLSA-N |
| XLogP | 5.04 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |