C29H33F2N7O4 — CID 90252624
methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate (PubChem CID 90252624) has the molecular formula C29H33F2N7O4 and a molecular weight of 581.62 g/mol. Its IUPAC name is methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate.
| Compound Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 90252624 |
| Molecular Formula | C29H33F2N7O4 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | methyl N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]carbamate |
| SMILES | COCCOc1cc(F)c(-c2ccc3cnc(Nc4cnccc4[C@H]4C[C@@H](N)[C@@H](NC(=O)OC)[C@@H](C)C4)n3n2)c(F)c1 |
| InChI | InChI=1S/C29H33F2N7O4/c1-16-10-17(11-23(32)27(16)36-29(39)41-3)20-6-7-33-15-25(20)35-28-34-14-18-4-5-24(37-38(18)28)26-21(30)12-19(13-22(26)31)42-9-8-40-2/h4-7,12-17,23,27H,8-11,32H2,1-3H3,(H,34,35)(H,36,39)/t16-,17+,23+,27-/m0/s1 |
| InChIKey | YYNRSCDOQXFDAB-SQMLSJJLSA-N |
| XLogP | 4.40 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|