About (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol
(2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol (PubChem CID 90252851) has the molecular formula C16H11F6N3O
and a molecular weight of 375.27 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol.
Molecular Properties
| Compound Name | (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol |
| PubChem CID | 90252851 |
| Molecular Formula | C16H11F6N3O |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol |
| SMILES | C[C@](O)(c1cncc(-n2nc(C(F)(F)F)c3ccccc32)c1)C(F)(F)F |
| InChI | InChI=1S/C16H11F6N3O/c1-14(26,16(20,21)22)9-6-10(8-23-7-9)25-12-5-3-2-4-11(12)13(24-25)15(17,18)19/h2-8,26H,1H3/t14-/m0/s1 |
| InChIKey | JARSMHCNHDDFGP-AWEZNQCLSA-N |
| XLogP | 4.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol?
The IUPAC name of (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol (CID 90252851) is (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol.
What is the SMILES notation for (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol?
The canonical SMILES for (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol is C[C@](O)(c1cncc(-n2nc(C(F)(F)F)c3ccccc32)c1)C(F)(F)F.
What is the InChIKey of (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol?
The InChIKey is JARSMHCNHDDFGP-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H11F6N3O/c1-14(26,16(20,21)22)9-6-10(8-23-7-9)25-12-5-3-2-4-11(12)13(24-25)15(17,18)19/h2-8,26H,1H3/t14-/m0/s1.
What are the key properties of (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol?
(2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol has a molecular weight of 375.27 g/mol, XLogP of 4.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,1,1-trifluoro-2-[5-[3-(trifluoromethyl)indazol-1-yl]-3-pyridinyl]propan-2-ol is sourced from PubChem (CID 90252851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).