About (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol
(2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol (PubChem CID 90252852) has the molecular formula C16H14F3N3O
and a molecular weight of 321.30 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol.
Molecular Properties
| Compound Name | (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol |
| PubChem CID | 90252852 |
| Molecular Formula | C16H14F3N3O |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol |
| SMILES | Cc1nn(-c2cncc([C@@](C)(O)C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C16H14F3N3O/c1-10-13-5-3-4-6-14(13)22(21-10)12-7-11(8-20-9-12)15(2,23)16(17,18)19/h3-9,23H,1-2H3/t15-/m1/s1 |
| InChIKey | QZDITHIIKPAORB-OAHLLOKOSA-N |
| XLogP | 3.50 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol?
The IUPAC name of (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol (CID 90252852) is (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol.
What is the SMILES notation for (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol?
The canonical SMILES for (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol is Cc1nn(-c2cncc([C@@](C)(O)C(F)(F)F)c2)c2ccccc12.
What is the InChIKey of (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol?
The InChIKey is QZDITHIIKPAORB-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H14F3N3O/c1-10-13-5-3-4-6-14(13)22(21-10)12-7-11(8-20-9-12)15(2,23)16(17,18)19/h3-9,23H,1-2H3/t15-/m1/s1.
What are the key properties of (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol?
(2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol has a molecular weight of 321.30 g/mol, XLogP of 3.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1,1-trifluoro-2-[5-(3-methylindazol-1-yl)-3-pyridinyl]propan-2-ol is sourced from PubChem (CID 90252852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).