About 5-iodo-N-methyl-2,3-dihydropyridin-2-amine
5-iodo-N-methyl-2,3-dihydropyridin-2-amine (PubChem CID 90253035) has the molecular formula C6H9IN2
and a molecular weight of 236.06 g/mol. Its IUPAC name is 5-iodo-N-methyl-2,3-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 5-iodo-N-methyl-2,3-dihydropyridin-2-amine |
| PubChem CID | 90253035 |
| Molecular Formula | C6H9IN2 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 5-iodo-N-methyl-2,3-dihydropyridin-2-amine |
| SMILES | CNC1CC=C(I)C=N1 |
| InChI | InChI=1S/C6H9IN2/c1-8-6-3-2-5(7)4-9-6/h2,4,6,8H,3H2,1H3 |
| InChIKey | XFRRDNUEROKQFO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-N-methyl-2,3-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-N-methyl-2,3-dihydropyridin-2-amine?
The IUPAC name of 5-iodo-N-methyl-2,3-dihydropyridin-2-amine (CID 90253035) is 5-iodo-N-methyl-2,3-dihydropyridin-2-amine.
What is the SMILES notation for 5-iodo-N-methyl-2,3-dihydropyridin-2-amine?
The canonical SMILES for 5-iodo-N-methyl-2,3-dihydropyridin-2-amine is CNC1CC=C(I)C=N1.
What is the InChIKey of 5-iodo-N-methyl-2,3-dihydropyridin-2-amine?
The InChIKey is XFRRDNUEROKQFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9IN2/c1-8-6-3-2-5(7)4-9-6/h2,4,6,8H,3H2,1H3.
What are the key properties of 5-iodo-N-methyl-2,3-dihydropyridin-2-amine?
5-iodo-N-methyl-2,3-dihydropyridin-2-amine has a molecular weight of 236.06 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-N-methyl-2,3-dihydropyridin-2-amine is sourced from PubChem (CID 90253035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).