C19H26O2S — CID 90253234
5-(2-methylsulfanylpropyl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione (PubChem CID 90253234) has the molecular formula C19H26O2S and a molecular weight of 318.48 g/mol. Its IUPAC name is 5-(2-methylsulfanylpropyl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione.
| Compound Name | 5-(2-methylsulfanylpropyl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 90253234 |
| Molecular Formula | C19H26O2S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 5-(2-methylsulfanylpropyl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
| SMILES | CSC(C)CC1CC(=O)C(c2c(C)cc(C)cc2C)C(=O)C1 |
| InChI | InChI=1S/C19H26O2S/c1-11-6-12(2)18(13(3)7-11)19-16(20)9-15(10-17(19)21)8-14(4)22-5/h6-7,14-15,19H,8-10H2,1-5H3 |
| InChIKey | JVSCZUZXEZYQRJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|