About 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane
2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane (PubChem CID 90253376) has the molecular formula C16H28F3N3
and a molecular weight of 319.42 g/mol. Its IUPAC name is 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane.
Molecular Properties
| Compound Name | 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane |
| PubChem CID | 90253376 |
| Molecular Formula | C16H28F3N3 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane |
| SMILES | CC1CNC(C2CNC(C3CCC(F)C(F)C3)C(F)C2)NC1 |
| InChI | InChI=1S/C16H28F3N3/c1-9-6-21-16(22-7-9)11-5-14(19)15(20-8-11)10-2-3-12(17)13(18)4-10/h9-16,20-22H,2-8H2,1H3 |
| InChIKey | RSXLUXGOAIWDLK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane?
The IUPAC name of 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane (CID 90253376) is 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane.
What is the SMILES notation for 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane?
The canonical SMILES for 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane is CC1CNC(C2CNC(C3CCC(F)C(F)C3)C(F)C2)NC1.
What is the InChIKey of 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane?
The InChIKey is RSXLUXGOAIWDLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28F3N3/c1-9-6-21-16(22-7-9)11-5-14(19)15(20-8-11)10-2-3-12(17)13(18)4-10/h9-16,20-22H,2-8H2,1H3.
What are the key properties of 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane?
2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane has a molecular weight of 319.42 g/mol, XLogP of 1.93, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(3,4-difluorocyclohexyl)-5-fluoropiperidin-3-yl]-5-methyl-1,3-diazinane is sourced from PubChem (CID 90253376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).