About 2-iodo-5-propyl-1,3-diazinane
2-iodo-5-propyl-1,3-diazinane (PubChem CID 90253398) has the molecular formula C7H15IN2
and a molecular weight of 254.11 g/mol. Its IUPAC name is 2-iodo-5-propyl-1,3-diazinane.
Molecular Properties
| Compound Name | 2-iodo-5-propyl-1,3-diazinane |
| PubChem CID | 90253398 |
| Molecular Formula | C7H15IN2 |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-iodo-5-propyl-1,3-diazinane |
| SMILES | CCCC1CNC(I)NC1 |
| InChI | InChI=1S/C7H15IN2/c1-2-3-6-4-9-7(8)10-5-6/h6-7,9-10H,2-5H2,1H3 |
| InChIKey | FJHZDYRMZSFYBO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-5-propyl-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-5-propyl-1,3-diazinane?
The IUPAC name of 2-iodo-5-propyl-1,3-diazinane (CID 90253398) is 2-iodo-5-propyl-1,3-diazinane.
What is the SMILES notation for 2-iodo-5-propyl-1,3-diazinane?
The canonical SMILES for 2-iodo-5-propyl-1,3-diazinane is CCCC1CNC(I)NC1.
What is the InChIKey of 2-iodo-5-propyl-1,3-diazinane?
The InChIKey is FJHZDYRMZSFYBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15IN2/c1-2-3-6-4-9-7(8)10-5-6/h6-7,9-10H,2-5H2,1H3.
What are the key properties of 2-iodo-5-propyl-1,3-diazinane?
2-iodo-5-propyl-1,3-diazinane has a molecular weight of 254.11 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-5-propyl-1,3-diazinane is sourced from PubChem (CID 90253398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).