C19H19F3N2O3 — CID 90253429
3-[[6-(2,2,2-trifluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]pyridine-4-carboxylic acid (PubChem CID 90253429) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is 3-[[6-(2,2,2-trifluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-[[6-(2,2,2-trifluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 90253429 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-[[6-(2,2,2-trifluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccncc1NCC1CCCc2cc(OCC(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H19F3N2O3/c20-19(21,22)11-27-14-4-5-15-12(8-14)2-1-3-13(15)9-24-17-10-23-7-6-16(17)18(25)26/h4-8,10,13,24H,1-3,9,11H2,(H,25,26) |
| InChIKey | BJZZDYPTYXMIAR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |