C8H13IO4 — CID 90253566
1-[(3R,4R,5R)-3,4-dihydroxy-5-iodooxan-2-yl]propan-2-one (PubChem CID 90253566) has the molecular formula C8H13IO4 and a molecular weight of 300.09 g/mol. Its IUPAC name is 1-[(3R,4R,5R)-3,4-dihydroxy-5-iodooxan-2-yl]propan-2-one.
| Compound Name | 1-[(3R,4R,5R)-3,4-dihydroxy-5-iodooxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 90253566 |
| Molecular Formula | C8H13IO4 |
| Molecular Weight | 300.09 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 1-[(3R,4R,5R)-3,4-dihydroxy-5-iodooxan-2-yl]propan-2-one |
| SMILES | CC(=O)CC1OC[C@@H](I)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H13IO4/c1-4(10)2-6-8(12)7(11)5(9)3-13-6/h5-8,11-12H,2-3H2,1H3/t5-,6?,7+,8+/m1/s1 |
| InChIKey | QCBSTQRUIZPESM-BJLRKGDGSA-N |
| XLogP | -0.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.09 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|