C15H20N8O4 — CID 90253601
2-[[4,6-bis(2-aminoethylamino)-1,3,5-triazin-2-yl]amino]terephthalic acid (PubChem CID 90253601) has the molecular formula C15H20N8O4 and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-[[4,6-bis(2-aminoethylamino)-1,3,5-triazin-2-yl]amino]terephthalic acid.
| Compound Name | 2-[[4,6-bis(2-aminoethylamino)-1,3,5-triazin-2-yl]amino]terephthalic acid |
|---|---|
| PubChem CID | 90253601 |
| Molecular Formula | C15H20N8O4 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-[[4,6-bis(2-aminoethylamino)-1,3,5-triazin-2-yl]amino]terephthalic acid |
| SMILES | NCCNc1nc(NCCN)nc(Nc2cc(C(=O)O)ccc2C(=O)O)n1 |
| InChI | InChI=1S/C15H20N8O4/c16-3-5-18-13-21-14(19-6-4-17)23-15(22-13)20-10-7-8(11(24)25)1-2-9(10)12(26)27/h1-2,7H,3-6,16-17H2,(H,24,25)(H,26,27)(H3,18,19,20,21,22,23) |
| InChIKey | UQECFMNQSRNRME-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 201.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |