C14H16F6O2 — CID 90253920
[2-(2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-methylprop-2-enoate (PubChem CID 90253920) has the molecular formula C14H16F6O2 and a molecular weight of 330.27 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2-(2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90253920 |
| Molecular Formula | C14H16F6O2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]heptanyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C1CC2CCC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H16F6O2/c1-7(2)11(21)22-12(13(15,16)17,14(18,19)20)10-6-8-3-4-9(10)5-8/h8-10H,1,3-6H2,2H3 |
| InChIKey | OKCIUTVTMJVTIA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|