C16H30N6O5 — CID 90253969
(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-N-[(2S)-1-hydrazinyl-1,4-dioxopentan-2-yl]pentanediamide (PubChem CID 90253969) has the molecular formula C16H30N6O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-N-[(2S)-1-hydrazinyl-1,4-dioxopentan-2-yl]pentanediamide.
| Compound Name | (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-N-[(2S)-1-hydrazinyl-1,4-dioxopentan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 90253969 |
| Molecular Formula | C16H30N6O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-N-[(2S)-1-hydrazinyl-1,4-dioxopentan-2-yl]pentanediamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)=O)C(=O)NN |
| InChI | InChI=1S/C16H30N6O5/c1-4-8(2)13(18)16(27)20-10(5-6-12(17)24)14(25)21-11(7-9(3)23)15(26)22-19/h8,10-11,13H,4-7,18-19H2,1-3H3,(H2,17,24)(H,20,27)(H,21,25)(H,22,26)/t8-,10-,11-,13-/m0/s1 |
| InChIKey | XADITEMLPHFCLU-DJFWLOJKSA-N |
| XLogP | -2.44 |
| TPSA | 199.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|