About (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one
(3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one (PubChem CID 90254109) has the molecular formula C15H29N3O3
and a molecular weight of 299.42 g/mol. Its IUPAC name is (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one.
Molecular Properties
| Compound Name | (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one |
| PubChem CID | 90254109 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one |
| SMILES | CC(=O)[C@H](C)NCC(CN[C@@H](C)C(C)=O)N[C@@H](C)C(C)=O |
| InChI | InChI=1S/C15H29N3O3/c1-9(12(4)19)16-7-15(18-11(3)14(6)21)8-17-10(2)13(5)20/h9-11,15-18H,7-8H2,1-6H3/t9-,10-,11-/m0/s1 |
| InChIKey | ZNQXIEAVYLOUBN-DCAQKATOSA-N |
| XLogP | 0.06 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one?
The IUPAC name of (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one (CID 90254109) is (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one.
What is the SMILES notation for (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one?
The canonical SMILES for (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one is CC(=O)[C@H](C)NCC(CN[C@@H](C)C(C)=O)N[C@@H](C)C(C)=O.
What is the InChIKey of (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one?
The InChIKey is ZNQXIEAVYLOUBN-DCAQKATOSA-N. The full InChI is InChI=1S/C15H29N3O3/c1-9(12(4)19)16-7-15(18-11(3)14(6)21)8-17-10(2)13(5)20/h9-11,15-18H,7-8H2,1-6H3/t9-,10-,11-/m0/s1.
What are the key properties of (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one?
(3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one has a molecular weight of 299.42 g/mol, XLogP of 0.06, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[2,3-bis[[(2S)-3-oxobutan-2-yl]amino]propylamino]butan-2-one is sourced from PubChem (CID 90254109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).