C19H21N3O — CID 90254123
3,3,5,5,16-pentamethyl-1,8,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7(12),8,10,13,16-hexaen-15-one (PubChem CID 90254123) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 3,3,5,5,16-pentamethyl-1,8,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7(12),8,10,13,16-hexaen-15-one.
| Compound Name | 3,3,5,5,16-pentamethyl-1,8,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7(12),8,10,13,16-hexaen-15-one |
|---|---|
| PubChem CID | 90254123 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 3,3,5,5,16-pentamethyl-1,8,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7(12),8,10,13,16-hexaen-15-one |
| SMILES | Cc1cn2c3c(c4ncccc4c2nc1=O)C(C)(C)CC3(C)C |
| InChI | InChI=1S/C19H21N3O/c1-11-9-22-15-13(18(2,3)10-19(15,4)5)14-12(7-6-8-20-14)16(22)21-17(11)23/h6-9H,10H2,1-5H3 |
| InChIKey | DEWCZWHFWCYBCX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|