C20H23N3O — CID 90254124
3,3,6,6,17-pentamethyl-1,9,15-triazatetracyclo[12.4.0.02,7.08,13]octadeca-2(7),8(13),9,11,14,17-hexaen-16-one (PubChem CID 90254124) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 3,3,6,6,17-pentamethyl-1,9,15-triazatetracyclo[12.4.0.02,7.08,13]octadeca-2(7),8(13),9,11,14,17-hexaen-16-one.
| Compound Name | 3,3,6,6,17-pentamethyl-1,9,15-triazatetracyclo[12.4.0.02,7.08,13]octadeca-2(7),8(13),9,11,14,17-hexaen-16-one |
|---|---|
| PubChem CID | 90254124 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 3,3,6,6,17-pentamethyl-1,9,15-triazatetracyclo[12.4.0.02,7.08,13]octadeca-2(7),8(13),9,11,14,17-hexaen-16-one |
| SMILES | Cc1cn2c3c(c4ncccc4c2nc1=O)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C20H23N3O/c1-12-11-23-16-14(19(2,3)8-9-20(16,4)5)15-13(7-6-10-21-15)17(23)22-18(12)24/h6-7,10-11H,8-9H2,1-5H3 |
| InChIKey | CFVSDHKXZQZEJN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|