C22H24N2O — CID 90254151
4,5,16,19,19-pentamethyl-3,13-diazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6,8,10,12-hexaen-14-one (PubChem CID 90254151) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 4,5,16,19,19-pentamethyl-3,13-diazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6,8,10,12-hexaen-14-one.
| Compound Name | 4,5,16,19,19-pentamethyl-3,13-diazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6,8,10,12-hexaen-14-one |
|---|---|
| PubChem CID | 90254151 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 4,5,16,19,19-pentamethyl-3,13-diazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6,8,10,12-hexaen-14-one |
| SMILES | Cc1c(C)n2c3c(c(=O)nc2c2ccccc12)C1(C)CCC3C1(C)C |
| InChI | InChI=1S/C22H24N2O/c1-12-13(2)24-18-16-10-11-22(5,21(16,3)4)17(18)20(25)23-19(24)15-9-7-6-8-14(12)15/h6-9,16H,10-11H2,1-5H3 |
| InChIKey | DQNZRQWOFHIUDB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|