C21H25N3O2 — CID 90254157
5-tert-butyl-12,12,14,14-tetramethyl-13-oxa-6,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one (PubChem CID 90254157) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 5-tert-butyl-12,12,14,14-tetramethyl-13-oxa-6,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one.
| Compound Name | 5-tert-butyl-12,12,14,14-tetramethyl-13-oxa-6,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one |
|---|---|
| PubChem CID | 90254157 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 5-tert-butyl-12,12,14,14-tetramethyl-13-oxa-6,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one |
| SMILES | CC(C)(C)c1ccc2c(ccn3c4c(c(=O)nc23)C(C)(C)OC4(C)C)n1 |
| InChI | InChI=1S/C21H25N3O2/c1-19(2,3)14-9-8-12-13(22-14)10-11-24-16-15(18(25)23-17(12)24)20(4,5)26-21(16,6)7/h8-11H,1-7H3 |
| InChIKey | ICCZIDQBPDJXPV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|