C27H23N3O2 — CID 90254158
16,16,18,18-tetramethyl-5-phenyl-17-oxa-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,19]henicosa-1(21),2(7),3,5,8,10,12,15(19)-octaen-20-one (PubChem CID 90254158) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 16,16,18,18-tetramethyl-5-phenyl-17-oxa-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,19]henicosa-1(21),2(7),3,5,8,10,12,15(19)-octaen-20-one.
| Compound Name | 16,16,18,18-tetramethyl-5-phenyl-17-oxa-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,19]henicosa-1(21),2(7),3,5,8,10,12,15(19)-octaen-20-one |
|---|---|
| PubChem CID | 90254158 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 16,16,18,18-tetramethyl-5-phenyl-17-oxa-6,14,21-triazapentacyclo[12.7.0.02,7.08,13.015,19]henicosa-1(21),2(7),3,5,8,10,12,15(19)-octaen-20-one |
| SMILES | CC1(C)OC(C)(C)c2c1c(=O)nc1c3ccc(-c4ccccc4)nc3c3ccccc3n21 |
| InChI | InChI=1S/C27H23N3O2/c1-26(2)21-23(27(3,4)32-26)30-20-13-9-8-12-17(20)22-18(24(30)29-25(21)31)14-15-19(28-22)16-10-6-5-7-11-16/h5-15H,1-4H3 |
| InChIKey | JZDLCHLLTUUKLU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|