C17H12O3 — CID 90254178
16-oxotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid (PubChem CID 90254178) has the molecular formula C17H12O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 16-oxotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid.
| Compound Name | 16-oxotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid |
|---|---|
| PubChem CID | 90254178 |
| Molecular Formula | C17H12O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 16-oxotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid |
| SMILES | O=C(O)C1C(=O)C2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C17H12O3/c18-16-14-11-7-3-1-5-9(11)13(15(16)17(19)20)10-6-2-4-8-12(10)14/h1-8,13-15H,(H,19,20) |
| InChIKey | CHPQEKJIGCSRJN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|