C23H27N3O — CID 90254202
8-tert-butyl-16,19,19-trimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6(11),7,9,12-hexaen-14-one (PubChem CID 90254202) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 8-tert-butyl-16,19,19-trimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6(11),7,9,12-hexaen-14-one.
| Compound Name | 8-tert-butyl-16,19,19-trimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6(11),7,9,12-hexaen-14-one |
|---|---|
| PubChem CID | 90254202 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 8-tert-butyl-16,19,19-trimethyl-3,7,13-triazapentacyclo[14.2.1.02,15.03,12.06,11]nonadeca-2(15),4,6(11),7,9,12-hexaen-14-one |
| SMILES | CC(C)(C)c1ccc2c(ccn3c4c(c(=O)nc23)C2(C)CCC4C2(C)C)n1 |
| InChI | InChI=1S/C23H27N3O/c1-21(2,3)16-8-7-13-15(24-16)10-12-26-18-14-9-11-23(6,22(14,4)5)17(18)20(27)25-19(13)26/h7-8,10,12,14H,9,11H2,1-6H3 |
| InChIKey | YMKQSVZHBZVKOV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|