C17H18O2 — CID 90254217
1,12-dimethyl-10-oxatetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3,5,7-tetraen-9-one (PubChem CID 90254217) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1,12-dimethyl-10-oxatetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3,5,7-tetraen-9-one.
| Compound Name | 1,12-dimethyl-10-oxatetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3,5,7-tetraen-9-one |
|---|---|
| PubChem CID | 90254217 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1,12-dimethyl-10-oxatetracyclo[10.2.2.02,11.03,8]hexadeca-2(11),3,5,7-tetraen-9-one |
| SMILES | CC12CCC(C)(CC1)c1c2oc(=O)c2ccccc12 |
| InChI | InChI=1S/C17H18O2/c1-16-7-9-17(2,10-8-16)14-13(16)11-5-3-4-6-12(11)15(18)19-14/h3-6H,7-10H2,1-2H3 |
| InChIKey | PFJAVDYUTPCHOB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |