C19H20N2O — CID 90254227
3,3,5,5-tetramethyl-1,14-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7,9,11,13,16-hexaen-15-one (PubChem CID 90254227) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1,14-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7,9,11,13,16-hexaen-15-one.
| Compound Name | 3,3,5,5-tetramethyl-1,14-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7,9,11,13,16-hexaen-15-one |
|---|---|
| PubChem CID | 90254227 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 3,3,5,5-tetramethyl-1,14-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7,9,11,13,16-hexaen-15-one |
| SMILES | CC1(C)CC(C)(C)c2c1c1ccccc1c1nc(=O)ccn21 |
| InChI | InChI=1S/C19H20N2O/c1-18(2)11-19(3,4)16-15(18)12-7-5-6-8-13(12)17-20-14(22)9-10-21(16)17/h5-10H,11H2,1-4H3 |
| InChIKey | WBTHMPSPOIFKMH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|