C23H29N3O — CID 90254234
6-(2,2-dimethylpropyl)-12,12,14,14-tetramethyl-5,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one (PubChem CID 90254234) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 6-(2,2-dimethylpropyl)-12,12,14,14-tetramethyl-5,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one.
| Compound Name | 6-(2,2-dimethylpropyl)-12,12,14,14-tetramethyl-5,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one |
|---|---|
| PubChem CID | 90254234 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 6-(2,2-dimethylpropyl)-12,12,14,14-tetramethyl-5,10,17-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2(7),3,5,8,11(15)-hexaen-16-one |
| SMILES | CC(C)(C)Cc1nccc2c1ccn1c3c(c(=O)nc21)C(C)(C)CC3(C)C |
| InChI | InChI=1S/C23H29N3O/c1-21(2,3)12-16-14-9-11-26-18-17(22(4,5)13-23(18,6)7)20(27)25-19(26)15(14)8-10-24-16/h8-11H,12-13H2,1-7H3 |
| InChIKey | XRQVDNQZOSKHCY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|