C15H9N3O — CID 90254240
1,9,15-triazatetracyclo[12.4.0.02,7.08,13]octadeca-2,4,6,8(13),9,11,14,17-octaen-16-one (PubChem CID 90254240) has the molecular formula C15H9N3O and a molecular weight of 247.26 g/mol. Its IUPAC name is 1,9,15-triazatetracyclo[12.4.0.02,7.08,13]octadeca-2,4,6,8(13),9,11,14,17-octaen-16-one.
| Compound Name | 1,9,15-triazatetracyclo[12.4.0.02,7.08,13]octadeca-2,4,6,8(13),9,11,14,17-octaen-16-one |
|---|---|
| PubChem CID | 90254240 |
| Molecular Formula | C15H9N3O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 1,9,15-triazatetracyclo[12.4.0.02,7.08,13]octadeca-2,4,6,8(13),9,11,14,17-octaen-16-one |
| SMILES | O=c1ccn2c3ccccc3c3ncccc3c2n1 |
| InChI | InChI=1S/C15H9N3O/c19-13-7-9-18-12-6-2-1-4-10(12)14-11(15(18)17-13)5-3-8-16-14/h1-9H |
| InChIKey | PHYFVXPSWQZQHM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|