C17H19N3O — CID 90254268
9-tert-butyl-3,4-dimethylpyrimido[2,1-f][1,6]naphthyridin-2-one (PubChem CID 90254268) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 9-tert-butyl-3,4-dimethylpyrimido[2,1-f][1,6]naphthyridin-2-one.
| Compound Name | 9-tert-butyl-3,4-dimethylpyrimido[2,1-f][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 90254268 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 9-tert-butyl-3,4-dimethylpyrimido[2,1-f][1,6]naphthyridin-2-one |
| SMILES | Cc1c(C)n2ccc3nc(C(C)(C)C)ccc3c2nc1=O |
| InChI | InChI=1S/C17H19N3O/c1-10-11(2)20-9-8-13-12(15(20)19-16(10)21)6-7-14(18-13)17(3,4)5/h6-9H,1-5H3 |
| InChIKey | SLYQVMAKBCCXJU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|