C20H25N3O — CID 90254277
4-(2,2-dimethylpropyl)-8-(2-methylpropyl)pyrimido[2,1-a][2,6]naphthyridin-2-one (PubChem CID 90254277) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-8-(2-methylpropyl)pyrimido[2,1-a][2,6]naphthyridin-2-one.
| Compound Name | 4-(2,2-dimethylpropyl)-8-(2-methylpropyl)pyrimido[2,1-a][2,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 90254277 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-8-(2-methylpropyl)pyrimido[2,1-a][2,6]naphthyridin-2-one |
| SMILES | CC(C)Cc1nccc2c1ccn1c(CC(C)(C)C)cc(=O)nc21 |
| InChI | InChI=1S/C20H25N3O/c1-13(2)10-17-15-7-9-23-14(12-20(3,4)5)11-18(24)22-19(23)16(15)6-8-21-17/h6-9,11,13H,10,12H2,1-5H3 |
| InChIKey | MYMDLPXKVDXYJK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|