C29H23N3O — CID 90254300
8-tert-butyl-3,7,13-triazaheptacyclo[14.6.6.02,15.03,12.06,11.017,22.023,28]octacosa-2(15),4,6(11),7,9,12,17,19,21,23,25,27-dodecaen-14-one (PubChem CID 90254300) has the molecular formula C29H23N3O and a molecular weight of 429.52 g/mol. Its IUPAC name is 8-tert-butyl-3,7,13-triazaheptacyclo[14.6.6.02,15.03,12.06,11.017,22.023,28]octacosa-2(15),4,6(11),7,9,12,17,19,21,23,25,27-dodecaen-14-one.
| Compound Name | 8-tert-butyl-3,7,13-triazaheptacyclo[14.6.6.02,15.03,12.06,11.017,22.023,28]octacosa-2(15),4,6(11),7,9,12,17,19,21,23,25,27-dodecaen-14-one |
|---|---|
| PubChem CID | 90254300 |
| Molecular Formula | C29H23N3O |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 8-tert-butyl-3,7,13-triazaheptacyclo[14.6.6.02,15.03,12.06,11.017,22.023,28]octacosa-2(15),4,6(11),7,9,12,17,19,21,23,25,27-dodecaen-14-one |
| SMILES | CC(C)(C)c1ccc2c(ccn3c4c(c(=O)nc23)C2c3ccccc3C4c3ccccc32)n1 |
| InChI | InChI=1S/C29H23N3O/c1-29(2,3)22-13-12-20-21(30-22)14-15-32-26-24-18-10-6-4-8-16(18)23(17-9-5-7-11-19(17)24)25(26)28(33)31-27(20)32/h4-15,23-24H,1-3H3 |
| InChIKey | BBKBRHQETGWDMK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|