C16H17FN2O8P+ — CID 90254338
[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium (PubChem CID 90254338) has the molecular formula C16H17FN2O8P+ and a molecular weight of 415.29 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium.
| Compound Name | [(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 90254338 |
| Molecular Formula | C16H17FN2O8P+ |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
| SMILES | C[C@]1(O)[C@H](n2ccc(=O)[nH]c2=O)O[C@](F)(CO[P+](=O)Oc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C16H16FN2O8P/c1-15(23)12(21)16(17,9-25-28(24)27-10-5-3-2-4-6-10)26-13(15)19-8-7-11(20)18-14(19)22/h2-8,12-13,21,23H,9H2,1H3/p+1/t12-,13+,15+,16+/m0/s1 |
| InChIKey | OQTVNNDFOGRAMA-SJXGUFTOSA-O |
| XLogP | 0.60 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|