About 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine
2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine (PubChem CID 90254503) has the molecular formula C13H19NS
and a molecular weight of 221.37 g/mol. Its IUPAC name is 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine |
| PubChem CID | 90254503 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine |
| SMILES | C=Cc1ccc(CSCCN(C)C)cc1 |
| InChI | InChI=1S/C13H19NS/c1-4-12-5-7-13(8-6-12)11-15-10-9-14(2)3/h4-8H,1,9-11H2,2-3H3 |
| InChIKey | NCQJVXBINXQZPK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine?
The IUPAC name of 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine (CID 90254503) is 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine is C=Cc1ccc(CSCCN(C)C)cc1.
What is the InChIKey of 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine?
The InChIKey is NCQJVXBINXQZPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NS/c1-4-12-5-7-13(8-6-12)11-15-10-9-14(2)3/h4-8H,1,9-11H2,2-3H3.
What are the key properties of 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine?
2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine has a molecular weight of 221.37 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethenylphenyl)methylsulfanyl]-N,N-dimethylethanamine is sourced from PubChem (CID 90254503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).