C44H37F5N2O8 — CID 90254521
(2,3,4,5,6-pentafluorophenyl) 2-[1-[6-[(4-methoxyphenyl)-diphenylmethoxy]hexylcarbamoyloxy]ethyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 90254521) has the molecular formula C44H37F5N2O8 and a molecular weight of 816.78 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[1-[6-[(4-methoxyphenyl)-diphenylmethoxy]hexylcarbamoyloxy]ethyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[1-[6-[(4-methoxyphenyl)-diphenylmethoxy]hexylcarbamoyloxy]ethyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 90254521 |
| Molecular Formula | C44H37F5N2O8 |
| Molecular Weight | 816.78 g/mol |
| Exact Mass | 816.25 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[1-[6-[(4-methoxyphenyl)-diphenylmethoxy]hexylcarbamoyloxy]ethyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(C(OCCCCCCNC(=O)OC(C)N2C(=O)c3ccc(C(=O)Oc4c(F)c(F)c(F)c(F)c4F)cc3C2=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C44H37F5N2O8/c1-26(51-40(52)32-22-17-27(25-33(32)41(51)53)42(54)59-39-37(48)35(46)34(45)36(47)38(39)49)58-43(55)50-23-11-3-4-12-24-57-44(28-13-7-5-8-14-28,29-15-9-6-10-16-29)30-18-20-31(56-2)21-19-30/h5-10,13-22,25-26H,3-4,11-12,23-24H2,1-2H3,(H,50,55) |
| InChIKey | LNXKAFVOAHLEQG-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.78 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|