C46H41F5N2O9 — CID 90254598
(2,3,4,5,6-pentafluorophenyl) 2-[3-[6-[bis(4-methoxyphenyl)-phenylmethoxy]hexoxycarbonylamino]propyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 90254598) has the molecular formula C46H41F5N2O9 and a molecular weight of 860.83 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[3-[6-[bis(4-methoxyphenyl)-phenylmethoxy]hexoxycarbonylamino]propyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[3-[6-[bis(4-methoxyphenyl)-phenylmethoxy]hexoxycarbonylamino]propyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 90254598 |
| Molecular Formula | C46H41F5N2O9 |
| Molecular Weight | 860.83 g/mol |
| Exact Mass | 860.27 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[3-[6-[bis(4-methoxyphenyl)-phenylmethoxy]hexoxycarbonylamino]propyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(C(OCCCCCCOC(=O)NCCCN2C(=O)c3ccc(C(=O)Oc4c(F)c(F)c(F)c(F)c4F)cc3C2=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C46H41F5N2O9/c1-58-32-18-14-30(15-19-32)46(29-11-6-5-7-12-29,31-16-20-33(59-2)21-17-31)61-26-9-4-3-8-25-60-45(57)52-23-10-24-53-42(54)34-22-13-28(27-35(34)43(53)55)44(56)62-41-39(50)37(48)36(47)38(49)40(41)51/h5-7,11-22,27H,3-4,8-10,23-26H2,1-2H3,(H,52,57) |
| InChIKey | ZOQQPZXRSFYBOO-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.83 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|