About N,N-di(propan-2-yl)prop-2-enamide;ruthenium
N,N-di(propan-2-yl)prop-2-enamide;ruthenium (PubChem CID 90254621) has the molecular formula C9H17NORu
and a molecular weight of 256.31 g/mol. Its IUPAC name is N,N-di(propan-2-yl)prop-2-enamide;ruthenium.
Molecular Properties
| Compound Name | N,N-di(propan-2-yl)prop-2-enamide;ruthenium |
| PubChem CID | 90254621 |
| Molecular Formula | C9H17NORu |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N,N-di(propan-2-yl)prop-2-enamide;ruthenium |
| SMILES | C=CC(=O)N(C(C)C)C(C)C.[Ru] |
| InChI | InChI=1S/C9H17NO.Ru/c1-6-9(11)10(7(2)3)8(4)5;/h6-8H,1H2,2-5H3; |
| InChIKey | FAKIZKSNOOQIMK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-di(propan-2-yl)prop-2-enamide;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-di(propan-2-yl)prop-2-enamide;ruthenium?
The IUPAC name of N,N-di(propan-2-yl)prop-2-enamide;ruthenium (CID 90254621) is N,N-di(propan-2-yl)prop-2-enamide;ruthenium.
What is the SMILES notation for N,N-di(propan-2-yl)prop-2-enamide;ruthenium?
The canonical SMILES for N,N-di(propan-2-yl)prop-2-enamide;ruthenium is C=CC(=O)N(C(C)C)C(C)C.[Ru].
What is the InChIKey of N,N-di(propan-2-yl)prop-2-enamide;ruthenium?
The InChIKey is FAKIZKSNOOQIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.Ru/c1-6-9(11)10(7(2)3)8(4)5;/h6-8H,1H2,2-5H3;.
What are the key properties of N,N-di(propan-2-yl)prop-2-enamide;ruthenium?
N,N-di(propan-2-yl)prop-2-enamide;ruthenium has a molecular weight of 256.31 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di(propan-2-yl)prop-2-enamide;ruthenium is sourced from PubChem (CID 90254621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).