About 4,5-diethoxychromen-2-one
4,5-diethoxychromen-2-one (PubChem CID 90255780) has the molecular formula C13H14O4
and a molecular weight of 234.25 g/mol. Its IUPAC name is 4,5-diethoxychromen-2-one.
Molecular Properties
| Compound Name | 4,5-diethoxychromen-2-one |
| PubChem CID | 90255780 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4,5-diethoxychromen-2-one |
| SMILES | CCOc1cccc2oc(=O)cc(OCC)c12 |
| InChI | InChI=1S/C13H14O4/c1-3-15-9-6-5-7-10-13(9)11(16-4-2)8-12(14)17-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | QKZHWCCOGVXQME-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diethoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethoxychromen-2-one?
The IUPAC name of 4,5-diethoxychromen-2-one (CID 90255780) is 4,5-diethoxychromen-2-one.
What is the SMILES notation for 4,5-diethoxychromen-2-one?
The canonical SMILES for 4,5-diethoxychromen-2-one is CCOc1cccc2oc(=O)cc(OCC)c12.
What is the InChIKey of 4,5-diethoxychromen-2-one?
The InChIKey is QKZHWCCOGVXQME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4/c1-3-15-9-6-5-7-10-13(9)11(16-4-2)8-12(14)17-10/h5-8H,3-4H2,1-2H3.
What are the key properties of 4,5-diethoxychromen-2-one?
4,5-diethoxychromen-2-one has a molecular weight of 234.25 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethoxychromen-2-one is sourced from PubChem (CID 90255780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).