C36H54F3N3O5Si2 — CID 90257600
6-[2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethoxymethyl]phenyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one (PubChem CID 90257600) has the molecular formula C36H54F3N3O5Si2 and a molecular weight of 722.01 g/mol. Its IUPAC name is 6-[2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethoxymethyl]phenyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one.
| Compound Name | 6-[2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethoxymethyl]phenyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 90257600 |
| Molecular Formula | C36H54F3N3O5Si2 |
| Molecular Weight | 722.01 g/mol |
| Exact Mass | 721.36 |
| IUPAC Name | 6-[2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethoxymethyl]phenyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
| SMILES | C[Si](C)(C)CCOCOc1cc(-c2ccccc2COCCC2CCN(CC(F)(F)F)CC2)cc2c(=O)n(COCC[Si](C)(C)C)cnc12 |
| InChI | InChI=1S/C36H54F3N3O5Si2/c1-48(2,3)19-17-45-26-42-25-40-34-32(35(42)43)21-30(22-33(34)47-27-46-18-20-49(4,5)6)31-10-8-7-9-29(31)23-44-16-13-28-11-14-41(15-12-28)24-36(37,38)39/h7-10,21-22,25,28H,11-20,23-24,26-27H2,1-6H3 |
| InChIKey | WHAZCXVNKJXSAT-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.01 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|