C35H53F3N4O5Si2 — CID 90257640
6-[2-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethoxymethyl]phenyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one (PubChem CID 90257640) has the molecular formula C35H53F3N4O5Si2 and a molecular weight of 723.00 g/mol. Its IUPAC name is 6-[2-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethoxymethyl]phenyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one.
| Compound Name | 6-[2-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethoxymethyl]phenyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 90257640 |
| Molecular Formula | C35H53F3N4O5Si2 |
| Molecular Weight | 723.00 g/mol |
| Exact Mass | 722.35 |
| IUPAC Name | 6-[2-[2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethoxymethyl]phenyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
| SMILES | C[Si](C)(C)CCOCOc1cc(-c2ccccc2COCCN2CCN(CC(F)(F)F)CC2)cc2c(=O)n(COCC[Si](C)(C)C)cnc12 |
| InChI | InChI=1S/C35H53F3N4O5Si2/c1-48(2,3)19-17-45-26-42-25-39-33-31(34(42)43)21-29(22-32(33)47-27-46-18-20-49(4,5)6)30-10-8-7-9-28(30)23-44-16-15-40-11-13-41(14-12-40)24-35(36,37)38/h7-10,21-22,25H,11-20,23-24,26-27H2,1-6H3 |
| InChIKey | BMJBEXYEMDJZDM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.00 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|