C17H18N4O2 — CID 90258546
methyl 5-[(5-amino-2-methylphenyl)methylamino]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate (PubChem CID 90258546) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is methyl 5-[(5-amino-2-methylphenyl)methylamino]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate.
| Compound Name | methyl 5-[(5-amino-2-methylphenyl)methylamino]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90258546 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | methyl 5-[(5-amino-2-methylphenyl)methylamino]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(NCc3cc(N)ccc3C)cnc2[nH]1 |
| InChI | InChI=1S/C17H18N4O2/c1-10-3-4-13(18)5-12(10)8-19-14-6-11-7-15(17(22)23-2)21-16(11)20-9-14/h3-7,9,19H,8,18H2,1-2H3,(H,20,21) |
| InChIKey | UIOGLLXXNYGBLU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|