C15H23ClN4O4S — CID 90258800
(1R,2R,3S,5R)-3-(7-chloro-5-propylsulfanyl-4H-triazolo[4,5-c]pyridin-3-yl)-5-(2-hydroxyethoxy)cyclopentane-1,2-diol (PubChem CID 90258800) has the molecular formula C15H23ClN4O4S and a molecular weight of 390.89 g/mol. Its IUPAC name is (1R,2R,3S,5R)-3-(7-chloro-5-propylsulfanyl-4H-triazolo[4,5-c]pyridin-3-yl)-5-(2-hydroxyethoxy)cyclopentane-1,2-diol.
| Compound Name | (1R,2R,3S,5R)-3-(7-chloro-5-propylsulfanyl-4H-triazolo[4,5-c]pyridin-3-yl)-5-(2-hydroxyethoxy)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 90258800 |
| Molecular Formula | C15H23ClN4O4S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (1R,2R,3S,5R)-3-(7-chloro-5-propylsulfanyl-4H-triazolo[4,5-c]pyridin-3-yl)-5-(2-hydroxyethoxy)cyclopentane-1,2-diol |
| SMILES | CCCSN1C=C(Cl)c2nnn([C@H]3C[C@@H](OCCO)[C@H](O)[C@@H]3O)c2C1 |
| InChI | InChI=1S/C15H23ClN4O4S/c1-2-5-25-19-7-9(16)13-11(8-19)20(18-17-13)10-6-12(24-4-3-21)15(23)14(10)22/h7,10,12,14-15,21-23H,2-6,8H2,1H3/t10-,12+,14+,15-/m0/s1 |
| InChIKey | QSGHHMNPILSGAI-BTQDYEIMSA-N |
| XLogP | 0.73 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|