About diethoxy-di(nonyl)silane
diethoxy-di(nonyl)silane (PubChem CID 90258978) has the molecular formula C22H48O2Si
and a molecular weight of 372.71 g/mol. Its IUPAC name is diethoxy-di(nonyl)silane.
Molecular Properties
| Compound Name | diethoxy-di(nonyl)silane |
| PubChem CID | 90258978 |
| Molecular Formula | C22H48O2Si |
| Molecular Weight | 372.71 g/mol |
| Exact Mass | 372.34 |
| IUPAC Name | diethoxy-di(nonyl)silane |
| SMILES | CCCCCCCCC[Si](CCCCCCCCC)(OCC)OCC |
| InChI | InChI=1S/C22H48O2Si/c1-5-9-11-13-15-17-19-21-25(23-7-3,24-8-4)22-20-18-16-14-12-10-6-2/h5-22H2,1-4H3 |
| InChIKey | FLXFRIBPJKRXQW-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.71 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy-di(nonyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy-di(nonyl)silane?
The IUPAC name of diethoxy-di(nonyl)silane (CID 90258978) is diethoxy-di(nonyl)silane.
What is the SMILES notation for diethoxy-di(nonyl)silane?
The canonical SMILES for diethoxy-di(nonyl)silane is CCCCCCCCC[Si](CCCCCCCCC)(OCC)OCC.
What is the InChIKey of diethoxy-di(nonyl)silane?
The InChIKey is FLXFRIBPJKRXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48O2Si/c1-5-9-11-13-15-17-19-21-25(23-7-3,24-8-4)22-20-18-16-14-12-10-6-2/h5-22H2,1-4H3.
What are the key properties of diethoxy-di(nonyl)silane?
diethoxy-di(nonyl)silane has a molecular weight of 372.71 g/mol, XLogP of 8.00, 20 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy-di(nonyl)silane is sourced from PubChem (CID 90258978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).